C16H25ClN2O — CID 18793272
(3-amino-3-oxopropyl)-[(4-ethenylphenyl)methyl]-diethylazanium chloride (PubChem CID 18793272) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is (3-amino-3-oxopropyl)-[(4-ethenylphenyl)methyl]-diethylazanium chloride.
| Compound Name | (3-amino-3-oxopropyl)-[(4-ethenylphenyl)methyl]-diethylazanium chloride |
|---|---|
| PubChem CID | 18793272 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (3-amino-3-oxopropyl)-[(4-ethenylphenyl)methyl]-diethylazanium chloride |
| SMILES | C=Cc1ccc(C[N+](CC)(CC)CCC(N)=O)cc1.[Cl-] |
| InChI | InChI=1S/C16H24N2O.ClH/c1-4-14-7-9-15(10-8-14)13-18(5-2,6-3)12-11-16(17)19;/h4,7-10H,1,5-6,11-13H2,2-3H3,(H-,17,19);1H |
| InChIKey | XOCGIYVMJGVXQV-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|