C23H19BrN4O7 — CID 18805985
ethyl (2E,3Z)-2-[[5-(4-bromophenyl)furan-2-yl]methylidene]-3-[(2,4-dinitrophenyl)hydrazinylidene]butanoate (PubChem CID 18805985) has the molecular formula C23H19BrN4O7 and a molecular weight of 543.33 g/mol. Its IUPAC name is ethyl (2E,3Z)-2-[[5-(4-bromophenyl)furan-2-yl]methylidene]-3-[(2,4-dinitrophenyl)hydrazinylidene]butanoate.
| Compound Name | ethyl (2E,3Z)-2-[[5-(4-bromophenyl)furan-2-yl]methylidene]-3-[(2,4-dinitrophenyl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 18805985 |
| Molecular Formula | C23H19BrN4O7 |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | ethyl (2E,3Z)-2-[[5-(4-bromophenyl)furan-2-yl]methylidene]-3-[(2,4-dinitrophenyl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)C(=C/c1ccc(-c2ccc(Br)cc2)o1)/C(C)=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H19BrN4O7/c1-3-34-23(29)19(13-18-9-11-22(35-18)15-4-6-16(24)7-5-15)14(2)25-26-20-10-8-17(27(30)31)12-21(20)28(32)33/h4-13,26H,3H2,1-2H3/b19-13+,25-14- |
| InChIKey | QALVBSYKFGXZED-APERUBQLSA-N |
| XLogP | 5.96 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|