C15H17N5O2S2 — CID 18817588
2-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-5-(4-methylpiperazin-1-yl)-1,3-oxazole-4-carbonitrile (PubChem CID 18817588) has the molecular formula C15H17N5O2S2 and a molecular weight of 363.47 g/mol. Its IUPAC name is 2-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-5-(4-methylpiperazin-1-yl)-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-5-(4-methylpiperazin-1-yl)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 18817588 |
| Molecular Formula | C15H17N5O2S2 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-[(E)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-5-(4-methylpiperazin-1-yl)-1,3-oxazole-4-carbonitrile |
| SMILES | CCN1C(=O)/C(=C\c2nc(C#N)c(N3CCN(C)CC3)o2)SC1=S |
| InChI | InChI=1S/C15H17N5O2S2/c1-3-20-13(21)11(24-15(20)23)8-12-17-10(9-16)14(22-12)19-6-4-18(2)5-7-19/h8H,3-7H2,1-2H3/b11-8+ |
| InChIKey | LSVCIGVHVMAIIF-DHZHZOJOSA-N |
| XLogP | 1.52 |
| TPSA | 76.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|