C52H48N8O8S4 — CID 163330596
acetic acid;bis(5-(4-benzylpiperidin-1-yl)-2-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,3-oxazole-4-carbonitrile) (PubChem CID 163330596) has the molecular formula C52H48N8O8S4 and a molecular weight of 1041.27 g/mol. Its IUPAC name is acetic acid;bis(5-(4-benzylpiperidin-1-yl)-2-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,3-oxazole-4-carbonitrile).
| Compound Name | acetic acid;bis(5-(4-benzylpiperidin-1-yl)-2-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,3-oxazole-4-carbonitrile) |
|---|---|
| PubChem CID | 163330596 |
| Molecular Formula | C52H48N8O8S4 |
| Molecular Weight | 1041.27 g/mol |
| Exact Mass | 1040.25 |
| IUPAC Name | acetic acid;bis(5-(4-benzylpiperidin-1-yl)-2-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,3-oxazole-4-carbonitrile) |
| SMILES | CC(=O)O.N#Cc1nc(/C=C2/SC(=S)N(Cc3ccco3)C2=O)oc1N1CCC(Cc2ccccc2)CC1.N#Cc1nc(/C=C2/SC(=S)N(Cc3ccco3)C2=O)oc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/2C25H22N4O3S2.C2H4O2/c2*26-15-20-24(28-10-8-18(9-11-28)13-17-5-2-1-3-6-17)32-22(27-20)14-21-23(30)29(25(33)34-21)16-19-7-4-12-31-19;1-2(3)4/h2*1-7,12,14,18H,8-11,13,16H2;1H3,(H,3,4)/b2*21-14+; |
| InChIKey | GLZSISSKUHYYKD-WSZUGLNLSA-N |
| XLogP | 10.09 |
| TPSA | 210.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.27 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|