C25H25N3O5S3 — CID 3784167
3-(furan-2-ylmethyl)-5-[[4-(4-methylphenyl)sulfonyl-5-(4-methylpiperidin-1-yl)-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3784167) has the molecular formula C25H25N3O5S3 and a molecular weight of 543.69 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-5-[[4-(4-methylphenyl)sulfonyl-5-(4-methylpiperidin-1-yl)-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(furan-2-ylmethyl)-5-[[4-(4-methylphenyl)sulfonyl-5-(4-methylpiperidin-1-yl)-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3784167 |
| Molecular Formula | C25H25N3O5S3 |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 3-(furan-2-ylmethyl)-5-[[4-(4-methylphenyl)sulfonyl-5-(4-methylpiperidin-1-yl)-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(C=C3SC(=S)N(Cc4ccco4)C3=O)oc2N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C25H25N3O5S3/c1-16-5-7-19(8-6-16)36(30,31)22-24(27-11-9-17(2)10-12-27)33-21(26-22)14-20-23(29)28(25(34)35-20)15-18-4-3-13-32-18/h3-8,13-14,17H,9-12,15H2,1-2H3 |
| InChIKey | FZYPADWQILFXEN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 96.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|