C23H21N3O5S3 — CID 3731760
3-(furan-2-ylmethyl)-5-[[4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3731760) has the molecular formula C23H21N3O5S3 and a molecular weight of 515.64 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-5-[[4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(furan-2-ylmethyl)-5-[[4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3731760 |
| Molecular Formula | C23H21N3O5S3 |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | 3-(furan-2-ylmethyl)-5-[[4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(C=C3SC(=S)N(Cc4ccco4)C3=O)oc2N2CCCC2)cc1 |
| InChI | InChI=1S/C23H21N3O5S3/c1-15-6-8-17(9-7-15)34(28,29)20-22(25-10-2-3-11-25)31-19(24-20)13-18-21(27)26(23(32)33-18)14-16-5-4-12-30-16/h4-9,12-13H,2-3,10-11,14H2,1H3 |
| InChIKey | QJGVLKMBMAAYOG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|