C21H23N3O4S3 — CID 3611069
3-methyl-5-[[4-(4-methylphenyl)sulfonyl-5-(4-methylpiperidin-1-yl)-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3611069) has the molecular formula C21H23N3O4S3 and a molecular weight of 477.63 g/mol. Its IUPAC name is 3-methyl-5-[[4-(4-methylphenyl)sulfonyl-5-(4-methylpiperidin-1-yl)-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-methyl-5-[[4-(4-methylphenyl)sulfonyl-5-(4-methylpiperidin-1-yl)-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3611069 |
| Molecular Formula | C21H23N3O4S3 |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 3-methyl-5-[[4-(4-methylphenyl)sulfonyl-5-(4-methylpiperidin-1-yl)-1,3-oxazol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(C=C3SC(=S)N(C)C3=O)oc2N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C21H23N3O4S3/c1-13-4-6-15(7-5-13)31(26,27)18-20(24-10-8-14(2)9-11-24)28-17(22-18)12-16-19(25)23(3)21(29)30-16/h4-7,12,14H,8-11H2,1-3H3 |
| InChIKey | JXEOCOSWMFISQE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|