C24H23N3O6S3 — CID 3759559
5-[[4-(3,4-dimethylphenyl)sulfonyl-5-morpholin-4-yl-1,3-oxazol-2-yl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3759559) has the molecular formula C24H23N3O6S3 and a molecular weight of 545.66 g/mol. Its IUPAC name is 5-[[4-(3,4-dimethylphenyl)sulfonyl-5-morpholin-4-yl-1,3-oxazol-2-yl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(3,4-dimethylphenyl)sulfonyl-5-morpholin-4-yl-1,3-oxazol-2-yl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3759559 |
| Molecular Formula | C24H23N3O6S3 |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | 5-[[4-(3,4-dimethylphenyl)sulfonyl-5-morpholin-4-yl-1,3-oxazol-2-yl]methylidene]-3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(C=C3SC(=S)N(Cc4ccco4)C3=O)oc2N2CCOCC2)cc1C |
| InChI | InChI=1S/C24H23N3O6S3/c1-15-5-6-18(12-16(15)2)36(29,30)21-23(26-7-10-31-11-8-26)33-20(25-21)13-19-22(28)27(24(34)35-19)14-17-4-3-9-32-17/h3-6,9,12-13H,7-8,10-11,14H2,1-2H3 |
| InChIKey | YUZDQONFOBKHOI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 106.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|