C27H27N3O4S3 — CID 3539664
5-[[4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-1,3-oxazol-2-yl]methylidene]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3539664) has the molecular formula C27H27N3O4S3 and a molecular weight of 553.73 g/mol. Its IUPAC name is 5-[[4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-1,3-oxazol-2-yl]methylidene]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-1,3-oxazol-2-yl]methylidene]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3539664 |
| Molecular Formula | C27H27N3O4S3 |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 5-[[4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-1,3-oxazol-2-yl]methylidene]-3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(C=C3SC(=S)N(CCCc4ccccc4)C3=O)oc2N2CCCC2)cc1 |
| InChI | InChI=1S/C27H27N3O4S3/c1-19-11-13-21(14-12-19)37(32,33)24-26(29-15-5-6-16-29)34-23(28-24)18-22-25(31)30(27(35)36-22)17-7-10-20-8-3-2-4-9-20/h2-4,8-9,11-14,18H,5-7,10,15-17H2,1H3 |
| InChIKey | DLBQETMOPSYNDI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|