C22H25N3O4S3 — CID 5216356
5-[[4-(4-methylphenyl)sulfonyl-5-piperidin-1-yl-1,3-oxazol-2-yl]methylidene]-3-propyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5216356) has the molecular formula C22H25N3O4S3 and a molecular weight of 491.66 g/mol. Its IUPAC name is 5-[[4-(4-methylphenyl)sulfonyl-5-piperidin-1-yl-1,3-oxazol-2-yl]methylidene]-3-propyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(4-methylphenyl)sulfonyl-5-piperidin-1-yl-1,3-oxazol-2-yl]methylidene]-3-propyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5216356 |
| Molecular Formula | C22H25N3O4S3 |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 5-[[4-(4-methylphenyl)sulfonyl-5-piperidin-1-yl-1,3-oxazol-2-yl]methylidene]-3-propyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)C(=Cc2nc(S(=O)(=O)c3ccc(C)cc3)c(N3CCCCC3)o2)SC1=S |
| InChI | InChI=1S/C22H25N3O4S3/c1-3-11-25-20(26)17(31-22(25)30)14-18-23-19(21(29-18)24-12-5-4-6-13-24)32(27,28)16-9-7-15(2)8-10-16/h7-10,14H,3-6,11-13H2,1-2H3 |
| InChIKey | FROUPCSZBAAYII-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|