C15H16N4O3S2 — CID 6372165
5-(2,6-dimethylmorpholin-4-yl)-2-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-oxazole-4-carbonitrile (PubChem CID 6372165) has the molecular formula C15H16N4O3S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 5-(2,6-dimethylmorpholin-4-yl)-2-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-(2,6-dimethylmorpholin-4-yl)-2-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 6372165 |
| Molecular Formula | C15H16N4O3S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 5-(2,6-dimethylmorpholin-4-yl)-2-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,3-oxazole-4-carbonitrile |
| SMILES | CC1CN(c2oc(/C=C3\SC(=S)N(C)C3=O)nc2C#N)CC(C)O1 |
| InChI | InChI=1S/C15H16N4O3S2/c1-8-6-19(7-9(2)21-8)14-10(5-16)17-12(22-14)4-11-13(20)18(3)15(23)24-11/h4,8-9H,6-7H2,1-3H3/b11-4- |
| InChIKey | CNRGORLNIYSURE-WCIBSUBMSA-N |
| XLogP | 1.99 |
| TPSA | 82.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|