C23H27ClN4O2 — CID 18832881
4-(5-chloro-2-pyridin-2-yl-1H-indol-3-yl)-N-(2-morpholin-4-ylethyl)butanamide (PubChem CID 18832881) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 4-(5-chloro-2-pyridin-2-yl-1H-indol-3-yl)-N-(2-morpholin-4-ylethyl)butanamide.
| Compound Name | 4-(5-chloro-2-pyridin-2-yl-1H-indol-3-yl)-N-(2-morpholin-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 18832881 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 4-(5-chloro-2-pyridin-2-yl-1H-indol-3-yl)-N-(2-morpholin-4-ylethyl)butanamide |
| SMILES | O=C(CCCc1c(-c2ccccn2)[nH]c2ccc(Cl)cc12)NCCN1CCOCC1 |
| InChI | InChI=1S/C23H27ClN4O2/c24-17-7-8-20-19(16-17)18(23(27-20)21-5-1-2-9-25-21)4-3-6-22(29)26-10-11-28-12-14-30-15-13-28/h1-2,5,7-9,16,27H,3-4,6,10-15H2,(H,26,29) |
| InChIKey | OVDJOFRQGNAOQN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|