C21H10BrCl2NO3 — CID 18877512
N-(1-bromo-3-chloro-9,10-dioxoanthracen-2-yl)-2-chlorobenzamide (PubChem CID 18877512) has the molecular formula C21H10BrCl2NO3 and a molecular weight of 475.13 g/mol. Its IUPAC name is N-(1-bromo-3-chloro-9,10-dioxoanthracen-2-yl)-2-chlorobenzamide.
| Compound Name | N-(1-bromo-3-chloro-9,10-dioxoanthracen-2-yl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 18877512 |
| Molecular Formula | C21H10BrCl2NO3 |
| Molecular Weight | 475.13 g/mol |
| Exact Mass | 472.92 |
| IUPAC Name | N-(1-bromo-3-chloro-9,10-dioxoanthracen-2-yl)-2-chlorobenzamide |
| SMILES | O=C(Nc1c(Cl)cc2c(c1Br)C(=O)c1ccccc1C2=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H10BrCl2NO3/c22-17-16-13(19(26)10-5-1-2-6-11(10)20(16)27)9-15(24)18(17)25-21(28)12-7-3-4-8-14(12)23/h1-9H,(H,25,28) |
| InChIKey | WDIKGCFQVLQUCS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.13 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|