C24H37FN2O2 — CID 18922144
2-cyclopentyl-2-(2-fluorophenyl)-2-hydroxy-N-[1-(4-methylpentyl)piperidin-4-yl]acetamide (PubChem CID 18922144) has the molecular formula C24H37FN2O2 and a molecular weight of 404.57 g/mol. Its IUPAC name is 2-cyclopentyl-2-(2-fluorophenyl)-2-hydroxy-N-[1-(4-methylpentyl)piperidin-4-yl]acetamide.
| Compound Name | 2-cyclopentyl-2-(2-fluorophenyl)-2-hydroxy-N-[1-(4-methylpentyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 18922144 |
| Molecular Formula | C24H37FN2O2 |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 2-cyclopentyl-2-(2-fluorophenyl)-2-hydroxy-N-[1-(4-methylpentyl)piperidin-4-yl]acetamide |
| SMILES | CC(C)CCCN1CCC(NC(=O)C(O)(c2ccccc2F)C2CCCC2)CC1 |
| InChI | InChI=1S/C24H37FN2O2/c1-18(2)8-7-15-27-16-13-20(14-17-27)26-23(28)24(29,19-9-3-4-10-19)21-11-5-6-12-22(21)25/h5-6,11-12,18-20,29H,3-4,7-10,13-17H2,1-2H3,(H,26,28) |
| InChIKey | WYFFTAHRIPJXDV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |