C18H22N2O5S — CID 18930338
2-[2-[4-(6-methoxy-1,3-benzothiazole-2-carbonyl)piperidin-1-yl]ethoxy]acetic acid (PubChem CID 18930338) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[2-[4-(6-methoxy-1,3-benzothiazole-2-carbonyl)piperidin-1-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-(6-methoxy-1,3-benzothiazole-2-carbonyl)piperidin-1-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 18930338 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[2-[4-(6-methoxy-1,3-benzothiazole-2-carbonyl)piperidin-1-yl]ethoxy]acetic acid |
| SMILES | COc1ccc2nc(C(=O)C3CCN(CCOCC(=O)O)CC3)sc2c1 |
| InChI | InChI=1S/C18H22N2O5S/c1-24-13-2-3-14-15(10-13)26-18(19-14)17(23)12-4-6-20(7-5-12)8-9-25-11-16(21)22/h2-3,10,12H,4-9,11H2,1H3,(H,21,22) |
| InChIKey | FVGZRTHCSTXBIT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|