benzyl(triphenyl)stibanium chloride

C25H22ClSb — CID 18942535

IUPACbenzyl(triphenyl)stibanium chloride
SMILES[Cl-].c1ccc(C[Sb+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1
InChIInChI=1S/C7H7.3C6H5.ClH.Sb/c1-7-5-3-2-4-6-7;3*1-2-4-6-5-3-1;;/h2-6H,1H2;3*1-5H;1H;/q;;;;;+1/p-1
InChIKeyYQNWQSJCXDPSKC-UHFFFAOYSA-M
MW479.66 g/mol
LogP0.94
Rot. Bonds5

About benzyl(triphenyl)stibanium chloride

benzyl(triphenyl)stibanium chloride (PubChem CID 18942535) has the molecular formula C25H22ClSb and a molecular weight of 479.66 g/mol. Its IUPAC name is benzyl(triphenyl)stibanium chloride.

Molecular Properties

Compound Namebenzyl(triphenyl)stibanium chloride
PubChem CID18942535
Molecular FormulaC25H22ClSb
Molecular Weight479.66 g/mol
Exact Mass478.04
IUPAC Namebenzyl(triphenyl)stibanium chloride
SMILES[Cl-].c1ccc(C[Sb+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1
InChIInChI=1S/C7H7.3C6H5.ClH.Sb/c1-7-5-3-2-4-6-7;3*1-2-4-6-5-3-1;;/h2-6H,1H2;3*1-5H;1H;/q;;;;;+1/p-1
InChIKeyYQNWQSJCXDPSKC-UHFFFAOYSA-M
XLogP0.94
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds5
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500479.66
LogP ≤ 50.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze benzyl(triphenyl)stibanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl(triphenyl)stibanium chloride?
The IUPAC name of benzyl(triphenyl)stibanium chloride (CID 18942535) is benzyl(triphenyl)stibanium chloride.
What is the SMILES notation for benzyl(triphenyl)stibanium chloride?
The canonical SMILES for benzyl(triphenyl)stibanium chloride is [Cl-].c1ccc(C[Sb+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzyl(triphenyl)stibanium chloride?
The InChIKey is YQNWQSJCXDPSKC-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7.3C6H5.ClH.Sb/c1-7-5-3-2-4-6-7;3*1-2-4-6-5-3-1;;/h2-6H,1H2;3*1-5H;1H;/q;;;;;+1/p-1.
What are the key properties of benzyl(triphenyl)stibanium chloride?
benzyl(triphenyl)stibanium chloride has a molecular weight of 479.66 g/mol, XLogP of 0.94, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triphenyl)stibanium chloride is sourced from PubChem (CID 18942535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).