C29H38N2O5 — CID 18944161
2-[2-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]acetic acid (PubChem CID 18944161) has the molecular formula C29H38N2O5 and a molecular weight of 494.63 g/mol. Its IUPAC name is 2-[2-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]acetic acid.
| Compound Name | 2-[2-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 18944161 |
| Molecular Formula | C29H38N2O5 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 2-[2-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1Cc1ccccc1C(=O)NC(CO)C(=O)NCCCCC1CCCCC1 |
| InChI | InChI=1S/C29H38N2O5/c32-20-26(29(36)30-17-9-8-12-21-10-2-1-3-11-21)31-28(35)25-16-7-6-15-24(25)18-22-13-4-5-14-23(22)19-27(33)34/h4-7,13-16,21,26,32H,1-3,8-12,17-20H2,(H,30,36)(H,31,35)(H,33,34) |
| InChIKey | HDVRWLQZMNDWAY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|