C30H40N2O5 — CID 18944172
3-[3-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]propanoic acid (PubChem CID 18944172) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is 3-[3-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 18944172 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | 3-[3-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cccc(Cc2ccccc2C(=O)NC(CO)C(=O)NCCCCC2CCCCC2)c1 |
| InChI | InChI=1S/C30H40N2O5/c33-21-27(30(37)31-18-7-6-11-22-9-2-1-3-10-22)32-29(36)26-15-5-4-14-25(26)20-24-13-8-12-23(19-24)16-17-28(34)35/h4-5,8,12-15,19,22,27,33H,1-3,6-7,9-11,16-18,20-21H2,(H,31,37)(H,32,36)(H,34,35) |
| InChIKey | MYIUZBDPISMEBP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|