C29H40N2O4 — CID 67664774
3-[4-(4-cyclohexylbutylcarbamoyl)-2-methyl-3-[2-(1,3-oxazol-2-yl)cyclopentyl]phenyl]propanoic acid (PubChem CID 67664774) has the molecular formula C29H40N2O4 and a molecular weight of 480.65 g/mol. Its IUPAC name is 3-[4-(4-cyclohexylbutylcarbamoyl)-2-methyl-3-[2-(1,3-oxazol-2-yl)cyclopentyl]phenyl]propanoic acid.
| Compound Name | 3-[4-(4-cyclohexylbutylcarbamoyl)-2-methyl-3-[2-(1,3-oxazol-2-yl)cyclopentyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67664774 |
| Molecular Formula | C29H40N2O4 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | 3-[4-(4-cyclohexylbutylcarbamoyl)-2-methyl-3-[2-(1,3-oxazol-2-yl)cyclopentyl]phenyl]propanoic acid |
| SMILES | Cc1c(CCC(=O)O)ccc(C(=O)NCCCCC2CCCCC2)c1C1CCCC1c1ncco1 |
| InChI | InChI=1S/C29H40N2O4/c1-20-22(14-16-26(32)33)13-15-25(27(20)23-11-7-12-24(23)29-31-18-19-35-29)28(34)30-17-6-5-10-21-8-3-2-4-9-21/h13,15,18-19,21,23-24H,2-12,14,16-17H2,1H3,(H,30,34)(H,32,33) |
| InChIKey | TUCQDFXHAYCLKL-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|