C31H42N2O5 — CID 139618321
methyl 3-[3-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]propanoate (PubChem CID 139618321) has the molecular formula C31H42N2O5 and a molecular weight of 522.69 g/mol. Its IUPAC name is methyl 3-[3-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]propanoate.
| Compound Name | methyl 3-[3-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 139618321 |
| Molecular Formula | C31H42N2O5 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | methyl 3-[3-[[2-[[1-(4-cyclohexylbutylamino)-3-hydroxy-1-oxopropan-2-yl]carbamoyl]phenyl]methyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1cccc(Cc2ccccc2C(=O)NC(CO)C(=O)NCCCCC2CCCCC2)c1 |
| InChI | InChI=1S/C31H42N2O5/c1-38-29(35)18-17-24-13-9-14-25(20-24)21-26-15-5-6-16-27(26)30(36)33-28(22-34)31(37)32-19-8-7-12-23-10-3-2-4-11-23/h5-6,9,13-16,20,23,28,34H,2-4,7-8,10-12,17-19,21-22H2,1H3,(H,32,37)(H,33,36) |
| InChIKey | BLQFITZABJUIPN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|