C26H41N4O9P — CID 67698713
(4S)-5-(4-cyclohexylbutylamino)-4-[[(2S)-2-(methylcarbamoylamino)-3-(4-phosphonooxyphenyl)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 67698713) has the molecular formula C26H41N4O9P and a molecular weight of 584.61 g/mol. Its IUPAC name is (4S)-5-(4-cyclohexylbutylamino)-4-[[(2S)-2-(methylcarbamoylamino)-3-(4-phosphonooxyphenyl)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-(4-cyclohexylbutylamino)-4-[[(2S)-2-(methylcarbamoylamino)-3-(4-phosphonooxyphenyl)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67698713 |
| Molecular Formula | C26H41N4O9P |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | (4S)-5-(4-cyclohexylbutylamino)-4-[[(2S)-2-(methylcarbamoylamino)-3-(4-phosphonooxyphenyl)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CNC(=O)N[C@@H](Cc1ccc(OP(=O)(O)O)cc1)C(=O)N[C@@H](CCC(=O)O)C(=O)NCCCCC1CCCCC1 |
| InChI | InChI=1S/C26H41N4O9P/c1-27-26(35)30-22(17-19-10-12-20(13-11-19)39-40(36,37)38)25(34)29-21(14-15-23(31)32)24(33)28-16-6-5-9-18-7-3-2-4-8-18/h10-13,18,21-22H,2-9,14-17H2,1H3,(H,28,33)(H,29,34)(H,31,32)(H2,27,30,35)(H2,36,37,38)/t21-,22-/m0/s1 |
| InChIKey | FMLHACMVMBRANE-VXKWHMMOSA-N |
| XLogP | 2.21 |
| TPSA | 203.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|