C26H40N3O9P — CID 67580262
4-[[2-acetamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-7-cyclohexyl-4-(methylcarbamoyl)heptanoic acid (PubChem CID 67580262) has the molecular formula C26H40N3O9P and a molecular weight of 569.59 g/mol. Its IUPAC name is 4-[[2-acetamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-7-cyclohexyl-4-(methylcarbamoyl)heptanoic acid.
| Compound Name | 4-[[2-acetamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-7-cyclohexyl-4-(methylcarbamoyl)heptanoic acid |
|---|---|
| PubChem CID | 67580262 |
| Molecular Formula | C26H40N3O9P |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 4-[[2-acetamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-7-cyclohexyl-4-(methylcarbamoyl)heptanoic acid |
| SMILES | CNC(=O)C(CCCC1CCCCC1)(CCC(=O)O)NC(=O)C(Cc1ccc(OP(=O)(O)O)cc1)NC(C)=O |
| InChI | InChI=1S/C26H40N3O9P/c1-18(30)28-22(17-20-10-12-21(13-11-20)38-39(35,36)37)24(33)29-26(25(34)27-2,16-14-23(31)32)15-6-9-19-7-4-3-5-8-19/h10-13,19,22H,3-9,14-17H2,1-2H3,(H,27,34)(H,28,30)(H,29,33)(H,31,32)(H2,35,36,37) |
| InChIKey | XPNKAPDTVMVPKB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 191.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|