C22H33N2O8P — CID 67579640
2-carbamoyl-7-cyclohexyl-2-methyl-4-[(4-phosphonooxybenzoyl)amino]heptanoic acid (PubChem CID 67579640) has the molecular formula C22H33N2O8P and a molecular weight of 484.49 g/mol. Its IUPAC name is 2-carbamoyl-7-cyclohexyl-2-methyl-4-[(4-phosphonooxybenzoyl)amino]heptanoic acid.
| Compound Name | 2-carbamoyl-7-cyclohexyl-2-methyl-4-[(4-phosphonooxybenzoyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 67579640 |
| Molecular Formula | C22H33N2O8P |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 2-carbamoyl-7-cyclohexyl-2-methyl-4-[(4-phosphonooxybenzoyl)amino]heptanoic acid |
| SMILES | CC(CC(CCCC1CCCCC1)NC(=O)c1ccc(OP(=O)(O)O)cc1)(C(N)=O)C(=O)O |
| InChI | InChI=1S/C22H33N2O8P/c1-22(20(23)26,21(27)28)14-17(9-5-8-15-6-3-2-4-7-15)24-19(25)16-10-12-18(13-11-16)32-33(29,30)31/h10-13,15,17H,2-9,14H2,1H3,(H2,23,26)(H,24,25)(H,27,28)(H2,29,30,31) |
| InChIKey | XLRAGKGFANJPEB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 176.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|