C26H40N3O8P — CID 67580292
2-[[2-acetamido-3-(4-phosphonophenyl)propanoyl]amino]-5-[3-cyclohexylpropyl(methyl)amino]-5-oxopentanoic acid (PubChem CID 67580292) has the molecular formula C26H40N3O8P and a molecular weight of 553.59 g/mol. Its IUPAC name is 2-[[2-acetamido-3-(4-phosphonophenyl)propanoyl]amino]-5-[3-cyclohexylpropyl(methyl)amino]-5-oxopentanoic acid.
| Compound Name | 2-[[2-acetamido-3-(4-phosphonophenyl)propanoyl]amino]-5-[3-cyclohexylpropyl(methyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67580292 |
| Molecular Formula | C26H40N3O8P |
| Molecular Weight | 553.59 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 2-[[2-acetamido-3-(4-phosphonophenyl)propanoyl]amino]-5-[3-cyclohexylpropyl(methyl)amino]-5-oxopentanoic acid |
| SMILES | CC(=O)NC(Cc1ccc(P(=O)(O)O)cc1)C(=O)NC(CCC(=O)N(C)CCCC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C26H40N3O8P/c1-18(30)27-23(17-20-10-12-21(13-11-20)38(35,36)37)25(32)28-22(26(33)34)14-15-24(31)29(2)16-6-9-19-7-4-3-5-8-19/h10-13,19,22-23H,3-9,14-17H2,1-2H3,(H,27,30)(H,28,32)(H,33,34)(H2,35,36,37) |
| InChIKey | VUPWZVDFFRUBKF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.59 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|