C16H32O2 — CID 18949453
3-(5-ethyl-2,2,3,5,6,6-hexamethylheptan-3-yl)dioxirane (PubChem CID 18949453) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 3-(5-ethyl-2,2,3,5,6,6-hexamethylheptan-3-yl)dioxirane.
| Compound Name | 3-(5-ethyl-2,2,3,5,6,6-hexamethylheptan-3-yl)dioxirane |
|---|---|
| PubChem CID | 18949453 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 3-(5-ethyl-2,2,3,5,6,6-hexamethylheptan-3-yl)dioxirane |
| SMILES | CCC(C)(CC(C)(C1OO1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H32O2/c1-10-15(8,13(2,3)4)11-16(9,12-17-18-12)14(5,6)7/h12H,10-11H2,1-9H3 |
| InChIKey | ZKKJTRJXCNIKQC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|