About 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one
5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one (PubChem CID 18954613) has the molecular formula C27H28O4
and a molecular weight of 416.52 g/mol. Its IUPAC name is 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one.
Molecular Properties
| Compound Name | 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one |
| PubChem CID | 18954613 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one |
| SMILES | COC(OC)(C(=O)c1ccccc1CCCCC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28O4/c1-30-27(31-2,23-17-7-4-8-18-23)26(29)24-19-11-9-13-21(24)14-10-12-20-25(28)22-15-5-3-6-16-22/h3-9,11,13,15-19H,10,12,14,20H2,1-2H3 |
| InChIKey | BXKKKKSLNUQRHJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one?
The IUPAC name of 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one (CID 18954613) is 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one.
What is the SMILES notation for 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one?
The canonical SMILES for 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one is COC(OC)(C(=O)c1ccccc1CCCCC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one?
The InChIKey is BXKKKKSLNUQRHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28O4/c1-30-27(31-2,23-17-7-4-8-18-23)26(29)24-19-11-9-13-21(24)14-10-12-20-25(28)22-15-5-3-6-16-22/h3-9,11,13,15-19H,10,12,14,20H2,1-2H3.
What are the key properties of 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one?
5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one has a molecular weight of 416.52 g/mol, XLogP of 5.61, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,2-dimethoxy-2-phenylacetyl)phenyl]-1-phenylpentan-1-one is sourced from PubChem (CID 18954613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).