C18H15ClN4O5S — CID 18971398
methyl 2-[carbamoyl-[4-(1H-pyrazol-5-yl)phenyl]sulfonylamino]-4-chlorobenzoate (PubChem CID 18971398) has the molecular formula C18H15ClN4O5S and a molecular weight of 434.86 g/mol. Its IUPAC name is methyl 2-[carbamoyl-[4-(1H-pyrazol-5-yl)phenyl]sulfonylamino]-4-chlorobenzoate.
| Compound Name | methyl 2-[carbamoyl-[4-(1H-pyrazol-5-yl)phenyl]sulfonylamino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 18971398 |
| Molecular Formula | C18H15ClN4O5S |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | methyl 2-[carbamoyl-[4-(1H-pyrazol-5-yl)phenyl]sulfonylamino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1N(C(N)=O)S(=O)(=O)c1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C18H15ClN4O5S/c1-28-17(24)14-7-4-12(19)10-16(14)23(18(20)25)29(26,27)13-5-2-11(3-6-13)15-8-9-21-22-15/h2-10H,1H3,(H2,20,25)(H,21,22) |
| InChIKey | URDCFSJBNMIDHS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |