C16H11Cl2F2NO — CID 18972712
2-(2-amino-5-chlorophenyl)-1-chloro-1,1-difluoro-4-phenylbut-3-yn-2-ol (PubChem CID 18972712) has the molecular formula C16H11Cl2F2NO and a molecular weight of 342.17 g/mol. Its IUPAC name is 2-(2-amino-5-chlorophenyl)-1-chloro-1,1-difluoro-4-phenylbut-3-yn-2-ol.
| Compound Name | 2-(2-amino-5-chlorophenyl)-1-chloro-1,1-difluoro-4-phenylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 18972712 |
| Molecular Formula | C16H11Cl2F2NO |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2-(2-amino-5-chlorophenyl)-1-chloro-1,1-difluoro-4-phenylbut-3-yn-2-ol |
| SMILES | Nc1ccc(Cl)cc1C(O)(C#Cc1ccccc1)C(F)(F)Cl |
| InChI | InChI=1S/C16H11Cl2F2NO/c17-12-6-7-14(21)13(10-12)15(22,16(18,19)20)9-8-11-4-2-1-3-5-11/h1-7,10,22H,21H2 |
| InChIKey | VTLXWXHOXZCZHC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|