C29H21ClF3NO — CID 15449183
2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluorobut-3-yn-2-ol (PubChem CID 15449183) has the molecular formula C29H21ClF3NO and a molecular weight of 491.94 g/mol. Its IUPAC name is 2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluorobut-3-yn-2-ol.
| Compound Name | 2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluorobut-3-yn-2-ol |
|---|---|
| PubChem CID | 15449183 |
| Molecular Formula | C29H21ClF3NO |
| Molecular Weight | 491.94 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluorobut-3-yn-2-ol |
| SMILES | C#CC(O)(c1cc(Cl)ccc1NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C29H21ClF3NO/c1-2-27(35,29(31,32)33)25-20-24(30)18-19-26(25)34-28(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h1,3-20,34-35H |
| InChIKey | JCXOSNXRPIUGED-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.94 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|