C36H27ClF3NO2 — CID 15449188
2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluoro-4-(4-methoxyphenyl)but-3-yn-2-ol (PubChem CID 15449188) has the molecular formula C36H27ClF3NO2 and a molecular weight of 598.06 g/mol. Its IUPAC name is 2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluoro-4-(4-methoxyphenyl)but-3-yn-2-ol.
| Compound Name | 2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluoro-4-(4-methoxyphenyl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 15449188 |
| Molecular Formula | C36H27ClF3NO2 |
| Molecular Weight | 598.06 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | 2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluoro-4-(4-methoxyphenyl)but-3-yn-2-ol |
| SMILES | COc1ccc(C#CC(O)(c2cc(Cl)ccc2NC(c2ccccc2)(c2ccccc2)c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C36H27ClF3NO2/c1-43-31-20-17-26(18-21-31)23-24-34(42,36(38,39)40)32-25-30(37)19-22-33(32)41-35(27-11-5-2-6-12-27,28-13-7-3-8-14-28)29-15-9-4-10-16-29/h2-22,25,41-42H,1H3 |
| InChIKey | GXWBMYMSZYWBBS-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.06 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|