C17H18N4O — CID 18975431
16-amino-16-butyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one (PubChem CID 18975431) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 16-amino-16-butyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one.
| Compound Name | 16-amino-16-butyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one |
|---|---|
| PubChem CID | 18975431 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 16-amino-16-butyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaen-7-one |
| SMILES | CCCCC1(N)c2ccccc2-c2[nH]c(=O)c3nccn3c21 |
| InChI | InChI=1S/C17H18N4O/c1-2-3-8-17(18)12-7-5-4-6-11(12)13-14(17)21-10-9-19-15(21)16(22)20-13/h4-7,9-10H,2-3,8,18H2,1H3,(H,20,22) |
| InChIKey | VHZMVYYMISOJBA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |