C13H8ClN3O — CID 18975471
12-chloro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one (PubChem CID 18975471) has the molecular formula C13H8ClN3O and a molecular weight of 257.68 g/mol. Its IUPAC name is 12-chloro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one.
| Compound Name | 12-chloro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one |
|---|---|
| PubChem CID | 18975471 |
| Molecular Formula | C13H8ClN3O |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 12-chloro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one |
| SMILES | O=c1[nH]c2c(n3ccnc13)Cc1ccc(Cl)cc1-2 |
| InChI | InChI=1S/C13H8ClN3O/c14-8-2-1-7-5-10-11(9(7)6-8)16-13(18)12-15-3-4-17(10)12/h1-4,6H,5H2,(H,16,18) |
| InChIKey | MYSGOFSGBLNZAM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |