C18H23F3O5S — CID 18979600
[4-[4-[2-(1,3-dioxolan-2-yl)ethyl]cyclohexyl]phenyl] trifluoromethanesulfonate (PubChem CID 18979600) has the molecular formula C18H23F3O5S and a molecular weight of 408.44 g/mol. Its IUPAC name is [4-[4-[2-(1,3-dioxolan-2-yl)ethyl]cyclohexyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[4-[2-(1,3-dioxolan-2-yl)ethyl]cyclohexyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18979600 |
| Molecular Formula | C18H23F3O5S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [4-[4-[2-(1,3-dioxolan-2-yl)ethyl]cyclohexyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C2CCC(CCC3OCCO3)CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H23F3O5S/c19-18(20,21)27(22,23)26-16-8-6-15(7-9-16)14-4-1-13(2-5-14)3-10-17-24-11-12-25-17/h6-9,13-14,17H,1-5,10-12H2 |
| InChIKey | OKNPOMMGCZNVFK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|