C15H17F3O5S — CID 19095000
[4-(1,4-dioxaspiro[4.5]decan-3-yl)phenyl] trifluoromethanesulfonate (PubChem CID 19095000) has the molecular formula C15H17F3O5S and a molecular weight of 366.36 g/mol. Its IUPAC name is [4-(1,4-dioxaspiro[4.5]decan-3-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-(1,4-dioxaspiro[4.5]decan-3-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19095000 |
| Molecular Formula | C15H17F3O5S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [4-(1,4-dioxaspiro[4.5]decan-3-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C2COC3(CCCCC3)O2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H17F3O5S/c16-15(17,18)24(19,20)23-12-6-4-11(5-7-12)13-10-21-14(22-13)8-2-1-3-9-14/h4-7,13H,1-3,8-10H2 |
| InChIKey | VZMXRZOZDQFKDQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|