C22H25N3O4S — CID 18980205
N,N-diethyl-4-(8-methyl-2,3-dioxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-5-yl)benzenesulfonamide (PubChem CID 18980205) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is N,N-diethyl-4-(8-methyl-2,3-dioxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-5-yl)benzenesulfonamide.
| Compound Name | N,N-diethyl-4-(8-methyl-2,3-dioxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 18980205 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N,N-diethyl-4-(8-methyl-2,3-dioxo-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-5-yl)benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2cc3c(c4c2CCN(C)C4)NC(=O)C3=O)cc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-4-25(5-2)30(28,29)15-8-6-14(7-9-15)17-12-18-20(23-22(27)21(18)26)19-13-24(3)11-10-16(17)19/h6-9,12H,4-5,10-11,13H2,1-3H3,(H,23,26,27) |
| InChIKey | XTPAUDWONINRCF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|