C22H26N4O6S — CID 57025411
N,N-bis(2-hydroxyethyl)-4-(8-methyl-3-nitroso-2-oxo-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-5-yl)benzenesulfonamide (PubChem CID 57025411) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-4-(8-methyl-3-nitroso-2-oxo-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-5-yl)benzenesulfonamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-4-(8-methyl-3-nitroso-2-oxo-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 57025411 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-4-(8-methyl-3-nitroso-2-oxo-3,6,7,9-tetrahydro-1H-pyrrolo[3,2-h]isoquinolin-5-yl)benzenesulfonamide |
| SMILES | CN1CCc2c(-c3ccc(S(=O)(=O)N(CCO)CCO)cc3)cc3c(c2C1)NC(=O)C3N=O |
| InChI | InChI=1S/C22H26N4O6S/c1-25-7-6-16-17(12-18-20(19(16)13-25)23-22(29)21(18)24-30)14-2-4-15(5-3-14)33(31,32)26(8-10-27)9-11-28/h2-5,12,21,27-28H,6-11,13H2,1H3,(H,23,29) |
| InChIKey | QZDFEUJMUYVNSM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |