About 2-chloro-3-methyl-1,2,4-thiadiazolidine
2-chloro-3-methyl-1,2,4-thiadiazolidine (PubChem CID 18999105) has the molecular formula C3H7ClN2S
and a molecular weight of 138.62 g/mol. Its IUPAC name is 2-chloro-3-methyl-1,2,4-thiadiazolidine.
Molecular Properties
| Compound Name | 2-chloro-3-methyl-1,2,4-thiadiazolidine |
| PubChem CID | 18999105 |
| Molecular Formula | C3H7ClN2S |
| Molecular Weight | 138.62 g/mol |
| Exact Mass | 138.00 |
| IUPAC Name | 2-chloro-3-methyl-1,2,4-thiadiazolidine |
| SMILES | CC1NCSN1Cl |
| InChI | InChI=1S/C3H7ClN2S/c1-3-5-2-7-6(3)4/h3,5H,2H2,1H3 |
| InChIKey | VCJXYTFNUAJISI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.62 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-methyl-1,2,4-thiadiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methyl-1,2,4-thiadiazolidine?
The IUPAC name of 2-chloro-3-methyl-1,2,4-thiadiazolidine (CID 18999105) is 2-chloro-3-methyl-1,2,4-thiadiazolidine.
What is the SMILES notation for 2-chloro-3-methyl-1,2,4-thiadiazolidine?
The canonical SMILES for 2-chloro-3-methyl-1,2,4-thiadiazolidine is CC1NCSN1Cl.
What is the InChIKey of 2-chloro-3-methyl-1,2,4-thiadiazolidine?
The InChIKey is VCJXYTFNUAJISI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7ClN2S/c1-3-5-2-7-6(3)4/h3,5H,2H2,1H3.
What are the key properties of 2-chloro-3-methyl-1,2,4-thiadiazolidine?
2-chloro-3-methyl-1,2,4-thiadiazolidine has a molecular weight of 138.62 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methyl-1,2,4-thiadiazolidine is sourced from PubChem (CID 18999105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).