C5H13N3S — CID 21494164
1,2-dimethyl-5-sulfanyl-1,3,5-triazinane (PubChem CID 21494164) has the molecular formula C5H13N3S and a molecular weight of 147.25 g/mol. Its IUPAC name is 1,2-dimethyl-5-sulfanyl-1,3,5-triazinane.
| Compound Name | 1,2-dimethyl-5-sulfanyl-1,3,5-triazinane |
|---|---|
| PubChem CID | 21494164 |
| Molecular Formula | C5H13N3S |
| Molecular Weight | 147.25 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 1,2-dimethyl-5-sulfanyl-1,3,5-triazinane |
| SMILES | CC1NCN(S)CN1C |
| InChI | InChI=1S/C5H13N3S/c1-5-6-3-8(9)4-7(5)2/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | YIKNTMRREAYXPV-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|