C6H11NO4S — CID 19002523
2-amino-3-(2-hydroxypropanoylsulfanyl)propanoic acid (PubChem CID 19002523) has the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. Its IUPAC name is 2-amino-3-(2-hydroxypropanoylsulfanyl)propanoic acid.
| Compound Name | 2-amino-3-(2-hydroxypropanoylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 19002523 |
| Molecular Formula | C6H11NO4S |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 2-amino-3-(2-hydroxypropanoylsulfanyl)propanoic acid |
| SMILES | CC(O)C(=O)SCC(N)C(=O)O |
| InChI | InChI=1S/C6H11NO4S/c1-3(8)6(11)12-2-4(7)5(9)10/h3-4,8H,2,7H2,1H3,(H,9,10) |
| InChIKey | SRTPBDVCLYHKFK-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|