C19H19N3O4S — CID 19007070
N-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]quinoline-5-sulfonamide (PubChem CID 19007070) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]quinoline-5-sulfonamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 19007070 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]quinoline-5-sulfonamide |
| SMILES | O=S(=O)(NCCNCc1ccc2c(c1)OCO2)c1cccc2ncccc12 |
| InChI | InChI=1S/C19H19N3O4S/c23-27(24,19-5-1-4-16-15(19)3-2-8-21-16)22-10-9-20-12-14-6-7-17-18(11-14)26-13-25-17/h1-8,11,20,22H,9-10,12-13H2 |
| InChIKey | HYJCRKLULMNAHO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|