C15H9ClF7NO4 — CID 19018394
N-(4-chloro-3-ethoxy-1-oxoisochromen-7-yl)-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 19018394) has the molecular formula C15H9ClF7NO4 and a molecular weight of 435.68 g/mol. Its IUPAC name is N-(4-chloro-3-ethoxy-1-oxoisochromen-7-yl)-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-(4-chloro-3-ethoxy-1-oxoisochromen-7-yl)-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 19018394 |
| Molecular Formula | C15H9ClF7NO4 |
| Molecular Weight | 435.68 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | N-(4-chloro-3-ethoxy-1-oxoisochromen-7-yl)-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CCOc1oc(=O)c2cc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)ccc2c1Cl |
| InChI | InChI=1S/C15H9ClF7NO4/c1-2-27-11-9(16)7-4-3-6(5-8(7)10(25)28-11)24-12(26)13(17,18)14(19,20)15(21,22)23/h3-5H,2H2,1H3,(H,24,26) |
| InChIKey | LPHYCQKYGKPEOP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|