C18H22ClFO2 — CID 19019249
2-(4-chloro-3-fluorophenyl)-5-(4-ethenylcyclohexyl)-1,3-dioxane (PubChem CID 19019249) has the molecular formula C18H22ClFO2 and a molecular weight of 324.82 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-5-(4-ethenylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-5-(4-ethenylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 19019249 |
| Molecular Formula | C18H22ClFO2 |
| Molecular Weight | 324.82 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-5-(4-ethenylcyclohexyl)-1,3-dioxane |
| SMILES | C=CC1CCC(C2COC(c3ccc(Cl)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C18H22ClFO2/c1-2-12-3-5-13(6-4-12)15-10-21-18(22-11-15)14-7-8-16(19)17(20)9-14/h2,7-9,12-13,15,18H,1,3-6,10-11H2 |
| InChIKey | ZVVQHDXLSOUHTE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.82 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|