C10H18O4 — CID 19019562
2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid (PubChem CID 19019562) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid.
| Compound Name | 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 19019562 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid |
| SMILES | CC(CCCC1(C)OCCO1)C(=O)O |
| InChI | InChI=1S/C10H18O4/c1-8(9(11)12)4-3-5-10(2)13-6-7-14-10/h8H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | ZNINYJZWXHOYNY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |