About 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid
5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid (PubChem CID 15453756) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid.
Molecular Properties
| Compound Name | 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid |
| PubChem CID | 15453756 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid |
| SMILES | CC1(CCCCC(=O)O)OCCO1 |
| InChI | InChI=1S/C9H16O4/c1-9(12-6-7-13-9)5-3-2-4-8(10)11/h2-7H2,1H3,(H,10,11) |
| InChIKey | VYFHDOYKOOENAX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid?
The IUPAC name of 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid (CID 15453756) is 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid.
What is the SMILES notation for 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid?
The canonical SMILES for 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid is CC1(CCCCC(=O)O)OCCO1.
What is the InChIKey of 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid?
The InChIKey is VYFHDOYKOOENAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-9(12-6-7-13-9)5-3-2-4-8(10)11/h2-7H2,1H3,(H,10,11).
What are the key properties of 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid?
5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid has a molecular weight of 188.22 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-1,3-dioxolan-2-yl)pentanoic acid is sourced from PubChem (CID 15453756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).