C20H19F4NO3 — CID 19045051
2,2-dimethyl-N-[4-methyl-2-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)phenyl]propanamide (PubChem CID 19045051) has the molecular formula C20H19F4NO3 and a molecular weight of 397.37 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-methyl-2-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)phenyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-methyl-2-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 19045051 |
| Molecular Formula | C20H19F4NO3 |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2,2-dimethyl-N-[4-methyl-2-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)phenyl]propanamide |
| SMILES | Cc1ccc(NC(=O)C(C)(C)C)c(-c2cccc3c2OC(F)(F)C(F)(F)O3)c1 |
| InChI | InChI=1S/C20H19F4NO3/c1-11-8-9-14(25-17(26)18(2,3)4)13(10-11)12-6-5-7-15-16(12)28-20(23,24)19(21,22)27-15/h5-10H,1-4H3,(H,25,26) |
| InChIKey | DFCJPNSOAKGQDW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|