C22H27N3O5S — CID 19045566
6-[2-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)sulfanylethyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 19045566) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is 6-[2-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)sulfanylethyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[2-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)sulfanylethyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19045566 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 6-[2-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)sulfanylethyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)CC1(CCN(SCCc3cc(=O)n(C)c(=O)n3C)CC1)O2 |
| InChI | InChI=1S/C22H27N3O5S/c1-23-15(12-20(27)24(2)21(23)28)6-11-31-25-9-7-22(8-10-25)14-18(26)17-13-16(29-3)4-5-19(17)30-22/h4-5,12-13H,6-11,14H2,1-3H3 |
| InChIKey | SEMQXUPWOXPOHO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|