C23H31NO7S — CID 19046534
[2,6-di(propan-2-yl)-3-[2-(2,4,6-trimethoxyphenyl)acetyl]phenyl] sulfamate (PubChem CID 19046534) has the molecular formula C23H31NO7S and a molecular weight of 465.57 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)-3-[2-(2,4,6-trimethoxyphenyl)acetyl]phenyl] sulfamate.
| Compound Name | [2,6-di(propan-2-yl)-3-[2-(2,4,6-trimethoxyphenyl)acetyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 19046534 |
| Molecular Formula | C23H31NO7S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | [2,6-di(propan-2-yl)-3-[2-(2,4,6-trimethoxyphenyl)acetyl]phenyl] sulfamate |
| SMILES | COc1cc(OC)c(CC(=O)c2ccc(C(C)C)c(OS(N)(=O)=O)c2C(C)C)c(OC)c1 |
| InChI | InChI=1S/C23H31NO7S/c1-13(2)16-8-9-17(22(14(3)4)23(16)31-32(24,26)27)19(25)12-18-20(29-6)10-15(28-5)11-21(18)30-7/h8-11,13-14H,12H2,1-7H3,(H2,24,26,27) |
| InChIKey | RNYUYZOQGFPICG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |