C28H21N3O5S2 — CID 19057471
(E)-4-[3-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 19057471) has the molecular formula C28H21N3O5S2 and a molecular weight of 543.63 g/mol. Its IUPAC name is (E)-4-[3-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 19057471 |
| Molecular Formula | C28H21N3O5S2 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | (E)-4-[3-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)CC(Sc5cccc(NC(=O)/C=C/C(=O)O)c5)C4=O)cc3)sc2c1 |
| InChI | InChI=1S/C28H21N3O5S2/c1-16-5-10-21-22(13-16)38-27(30-21)17-6-8-19(9-7-17)31-25(33)15-23(28(31)36)37-20-4-2-3-18(14-20)29-24(32)11-12-26(34)35/h2-14,23H,15H2,1H3,(H,29,32)(H,34,35)/b12-11+ |
| InChIKey | KOWROCISLQSDTC-VAWYXSNFSA-N |
| XLogP | 5.28 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|