C29H21N3O5S — CID 19059814
[2-(4-nitrophenyl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate (PubChem CID 19059814) has the molecular formula C29H21N3O5S and a molecular weight of 523.57 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 19059814 |
| Molecular Formula | C29H21N3O5S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2ccccc2)nc1SCCC(=O)OCC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H21N3O5S/c30-18-25-24(20-7-3-1-4-8-20)17-26(21-9-5-2-6-10-21)31-29(25)38-16-15-28(34)37-19-27(33)22-11-13-23(14-12-22)32(35)36/h1-14,17H,15-16,19H2 |
| InChIKey | WQZUNXFHPPXTFB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 123.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|