C19H20ClNO3S — CID 19074410
2-(3-chloro-1-phenylpropyl)-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one;ethene (PubChem CID 19074410) has the molecular formula C19H20ClNO3S and a molecular weight of 377.89 g/mol. Its IUPAC name is 2-(3-chloro-1-phenylpropyl)-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one;ethene.
| Compound Name | 2-(3-chloro-1-phenylpropyl)-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one;ethene |
|---|---|
| PubChem CID | 19074410 |
| Molecular Formula | C19H20ClNO3S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-(3-chloro-1-phenylpropyl)-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one;ethene |
| SMILES | C=C.O=C1CN(C(CCCl)c2ccccc2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H16ClNO3S.C2H4/c18-11-10-15(13-6-2-1-3-7-13)19-12-16(20)14-8-4-5-9-17(14)23(19,21)22;1-2/h1-9,15H,10-12H2;1-2H2 |
| InChIKey | AMIQYFYBSVCDNQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|